|
CAS#: 18354-26-2 Product: 2-Chloro-3,5,6-Trimethylbenzoic Acid No suppilers available for the product. |
| Name | 2-Chloro-3,5,6-Trimethylbenzoic Acid |
|---|---|
| Synonyms | 2-Chloro-3,5,6-Trimethyl-Benzoic Acid; Nsc96587; Benzoic Acid, 2-Chloro-3,5,6-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 |
| CAS Registry Number | 18354-26-2 |
| SMILES | C1=C(C(=C(C(=C1C)Cl)C(O)=O)C)C |
| InChI | 1S/C10H11ClO2/c1-5-4-6(2)9(11)8(7(5)3)10(12)13/h4H,1-3H3,(H,12,13) |
| InChIKey | UUXKFHFNMBOTDU-UHFFFAOYSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.792°C at 760 mmHg (Cal.) |
| Flash point | 149.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-3,5,6-Trimethylbenzoic Acid |