|
CAS#: 18388-99-3 Product: N-Trimethylsilyl-N-N-Butyl-N',N'-Diethylurea No suppilers available for the product. |
| Name | N-Trimethylsilyl-N-N-Butyl-N',N'-Diethylurea |
|---|---|
| Synonyms | 1-Butyl-3,3-Diethyl-1-Trimethylsilyl-Urea; Nsc 252168 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H28N2OSi |
| Molecular Weight | 244.45 |
| CAS Registry Number | 18388-99-3 |
| EINECS | 242-267-8 |
| SMILES | C(N(C(N(CC)CC)=O)[Si](C)(C)C)CCC |
| InChI | 1S/C12H28N2OSi/c1-7-10-11-14(16(4,5)6)12(15)13(8-2)9-3/h7-11H2,1-6H3 |
| InChIKey | UJPXKMUARILIQY-UHFFFAOYSA-N |
| Density | 0.892g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.541°C at 760 mmHg (Cal.) |
| Flash point | 121.048°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Trimethylsilyl-N-N-Butyl-N',N'-Diethylurea |