|
CAS#: 18429-78-2 Product: Famotine No suppilers available for the product. |
| Name | Famotine |
|---|---|
| Synonyms | Famotine; Famotina [Inn-Spanish]; Oprea1_513750 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 |
| CAS Registry Number | 18429-78-2 |
| SMILES | C2=C1C(=NCCC1=CC=C2)COC3=CC=C(Cl)C=C3 |
| InChI | 1S/C16H14ClNO/c17-13-5-7-14(8-6-13)19-11-16-15-4-2-1-3-12(15)9-10-18-16/h1-8H,9-11H2 |
| InChIKey | YHDHSSBAHPSMPM-UHFFFAOYSA-N |
| Density | 1.207g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.624°C at 760 mmHg (Cal.) |
| Flash point | 202.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Famotine |