|
CAS#: 18455-27-1 Product: Rubreserine No suppilers available for the product. |
| Name | Rubreserine |
|---|---|
| Synonyms | (3Ar,8Bs)-3,4,8B-Trimethyl-2,3A-Dihydro-1H-Pyrrolo[2,3-B]Indole-6,7-Quinone; Pyrrolo(2,3-B)Indole-5,6-Dione, 1,2,3,3A,8,8A-Hexahydro-1,3A,8-Trimethyl-, (3As-Cis)-; Rubreserine |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 |
| CAS Registry Number | 18455-27-1 |
| SMILES | [C@@H]23N(C1=CC(=O)C(=O)C=C1[C@@]2(CCN3C)C)C |
| InChI | 1S/C13H16N2O2/c1-13-4-5-14(2)12(13)15(3)9-7-11(17)10(16)6-8(9)13/h6-7,12H,4-5H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | HOQNKCYZDSDWJL-OLZOCXBDSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.526°C at 760 mmHg (Cal.) |
| Flash point | 157.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rubreserine |