|
CAS#: 18456-04-7 Product: 8-Hydroxy-5-oxoophiobola-3,6,19-trien-25-oic acid No suppilers available for the product. |
| Name | 8-Hydroxy-5-oxoophiobola-3,6,19-trien-25-oic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.55 |
| CAS Registry Number | 18456-04-7 |
| SMILES | CC1=CC(=O)/C/2=C(/C(C[C@H]3[C@H](CC[C@@]3(C[C@H]12)C)[C@@H](C)CCC=C(C)C)O)\C(=O)O |
| InChI | 1S/C25H36O4/c1-14(2)7-6-8-15(3)17-9-10-25(5)13-18-16(4)11-20(26)22(18)23(24(28)29)21(27)12-19(17)25/h7,11,15,17-19,21,27H,6,8-10,12-13H2,1-5H3,(H,28,29)/b23-22-/t15-,17+,18+,19-,21?,25+/m0/s1 |
| InChIKey | YNWCHERLWLNYDO-ZWQYIRPLSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 302.4±26.6°C (Cal.) |
| Refractive index | 1.556 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Hydroxy-5-oxoophiobola-3,6,19-trien-25-oic acid |