|
CAS#: 1850-15-3 Product: Dibenzoic Thioanhydride No suppilers available for the product. |
| Name | Dibenzoic Thioanhydride |
|---|---|
| Synonyms | Benzenecarbothioic Acid S-(Oxo-Phenylmethyl) Ester; Thiobenzoic Acid S-(Benzoyl) Ester; S-Phenylcarbonyl Benzenecarbothioate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O2S |
| Molecular Weight | 242.29 |
| CAS Registry Number | 1850-15-3 |
| SMILES | C2=C(C(SC(C1=CC=CC=C1)=O)=O)C=CC=C2 |
| InChI | 1S/C14H10O2S/c15-13(11-7-3-1-4-8-11)17-14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KIHBJERLDDVXHD-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.246°C at 760 mmHg (Cal.) |
| Flash point | 172.966°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dibenzoic Thioanhydride |