Online Database of Chemicals from Around the World
|
CAS#: 18556-07-5 Product: 1,2-Dihydro-4,10-Dimethoxy-alpha,alpha-Dimethyldifuro[2,3-b:3',2'-f]Quinoline-2-Methanol No suppilers available for the product. |
| Name | 1,2-Dihydro-4,10-Dimethoxy-alpha,alpha-Dimethyldifuro[2,3-b:3',2'-f]Quinoline-2-Methanol |
|---|---|
| Synonyms | Choisyine |
| Molecular Structure | ![CAS#: 18556-07-5, 1,2-Dihydro-4,10-Dimethoxy-alpha,alpha-Dimethyldifuro[2,3-b:3',2'-f]Quinoline-2-Methanol](/moreStructures/18556-07-5.gif) |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 |
| CAS Registry Number | 18556-07-5 |
| SMILES | C1=C(C4=C(C2=C1N=C3C(=C2OC)C=CO3)CC(C(O)(C)C)O4)OC |
| InChI | 1S/C18H19NO5/c1-18(2,20)13-7-10-14-11(8-12(21-3)15(10)24-13)19-17-9(5-6-23-17)16(14)22-4/h5-6,8,13,20H,7H2,1-4H3 |
| InChIKey | OCKCNDIOPSOBNM-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.014°C at 760 mmHg (Cal.) |
| Flash point | 261.038°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydro-4,10-Dimethoxy-alpha,alpha-Dimethyldifuro[2,3-b:3',2'-f]Quinoline-2-Methanol |