|
CAS#: 18588-57-3 Product: Etoprine No suppilers available for the product. |
| Name | Etoprine |
|---|---|
| Synonyms | 5-(3,4-Dichlorophenyl)-6-Ethyl-Pyrimidine-2,4-Diamine; [2-Amino-5-(3,4-Dichlorophenyl)-6-Ethyl-Pyrimidin-4-Yl]Amine; Ddep |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12Cl2N4 |
| Molecular Weight | 283.16 |
| CAS Registry Number | 18588-57-3 |
| SMILES | C1=C(C(=CC=C1C2=C(N=C(N=C2CC)N)N)Cl)Cl |
| InChI | 1S/C12H12Cl2N4/c1-2-9-10(11(15)18-12(16)17-9)6-3-4-7(13)8(14)5-6/h3-5H,2H2,1H3,(H4,15,16,17,18) |
| InChIKey | PXLPCZJACKUXGP-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.286°C at 760 mmHg (Cal.) |
| Flash point | 267.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Etoprine |