|
CAS#: 18645-49-3 Product: 1,2-Diallyl-1,1,2,2-Tetramethyldisilane No suppilers available for the product. |
| Name | 1,2-Diallyl-1,1,2,2-Tetramethyldisilane |
|---|---|
| Synonyms | 1,2-Diallyl-1,1,2,2-tetramethyldisilane # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H22Si2 |
| Molecular Weight | 198.45 |
| CAS Registry Number | 18645-49-3 |
| SMILES | C=C\C[Si](C)(C)[Si](C)(C)C\C=C |
| InChI | 1S/C10H22Si2/c1-7-9-11(3,4)12(5,6)10-8-2/h7-8H,1-2,9-10H2,3-6H3 |
| InChIKey | YKBHBENPDUXKBK-UHFFFAOYSA-N |
| Density | 0.777g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.033°C at 760 mmHg (Cal.) |
| Flash point | 51.269°C (Cal.) |
| Refractive index | 1.425 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Diallyl-1,1,2,2-Tetramethyldisilane |