|
CAS#: 18672-13-4 Product: 6-Amino-3-(4-Aminophenyl)-2H-1,3-Benzoxazin-4-One No suppilers available for the product. |
| Name | 6-Amino-3-(4-Aminophenyl)-2H-1,3-Benzoxazin-4-One |
|---|---|
| Synonyms | Brn 1588945; 4H-1,3-Benzoxazin-4-One, 6-Amino-3-(P-Aminophenyl)-2,3-Dihydro-; 6-Amino-3-(P-Aminophenyl)-2,3-Dihydro-4H-1,3-Benzoxazin-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 |
| CAS Registry Number | 18672-13-4 |
| SMILES | C1=C(N)C=CC3=C1C(=O)N(C2=CC=C(N)C=C2)CO3 |
| InChI | 1S/C14H13N3O2/c15-9-1-4-11(5-2-9)17-8-19-13-6-3-10(16)7-12(13)14(17)18/h1-7H,8,15-16H2 |
| InChIKey | MYCCIRTWWFFNLD-UHFFFAOYSA-N |
| Density | 1.39g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.032°C at 760 mmHg (Cal.) |
| Flash point | 294.311°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-3-(4-Aminophenyl)-2H-1,3-Benzoxazin-4-One |