|
CAS#: 18672-15-6 Product: 3-(4-Nitrophenyl)-2H-1,3-Benzoxazin-4-One No suppilers available for the product. |
| Name | 3-(4-Nitrophenyl)-2H-1,3-Benzoxazin-4-One |
|---|---|
| Synonyms | 2,3-Dihydro-3-(P-Nitrophenyl)-4H-1,3-Benzoxazin-4-One; 4H-1,3-Benzoxazin-4-One, 2,3-Dihydro-3-(P-Nitrophenyl)-; Brn 1589611 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 18672-15-6 |
| SMILES | C3=C(N1C(=O)C2=C(OC1)C=CC=C2)C=CC(=C3)[N+]([O-])=O |
| InChI | 1S/C14H10N2O4/c17-14-12-3-1-2-4-13(12)20-9-15(14)10-5-7-11(8-6-10)16(18)19/h1-8H,9H2 |
| InChIKey | RJFKAIOIBHHRQM-UHFFFAOYSA-N |
| Density | 1.416g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.407°C at 760 mmHg (Cal.) |
| Flash point | 254.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Nitrophenyl)-2H-1,3-Benzoxazin-4-One |