|
CAS#: 18713-51-4 Product: Tris(1-Bromomethyl-2-Bromoethyl)Phosphate No suppilers available for the product. |
| Name | Tris(1-Bromomethyl-2-Bromoethyl)Phosphate |
|---|---|
| Synonyms | Tris[2-Bromo-1-(Bromomethyl)Ethyl] Phosphate; Phosphoric Acid Tris[2-Bromo-1-(Bromomethyl)Ethyl] Ester; 2-Propanol, 1,3-Dibromo-, Phosphate (3:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15Br6O4P |
| Molecular Weight | 697.61 |
| CAS Registry Number | 18713-51-4 |
| SMILES | C(C(O[P](OC(CBr)CBr)(OC(CBr)CBr)=O)CBr)Br |
| InChI | 1S/C9H15Br6O4P/c10-1-7(2-11)17-20(16,18-8(3-12)4-13)19-9(5-14)6-15/h7-9H,1-6H2 |
| InChIKey | RZEYUZWXPABTCN-UHFFFAOYSA-N |
| Density | 2.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.188°C at 760 mmHg (Cal.) |
| Flash point | 269.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris(1-Bromomethyl-2-Bromoethyl)Phosphate |