|
CAS#: 1881-75-0 Product: 9-Fluoro-7-Methylbenz[a]Anthracene No suppilers available for the product. |
| Name | 9-Fluoro-7-Methylbenz[a]Anthracene |
|---|---|
| Synonyms | 9-Fluoro-7-Methyl-Benzo[B]Phenanthrene; 4-05-00-02565 (Beilstein Handbook Reference); 6-Fluoro-10-Methyl-1,2-Benzanthracene |
| Molecular Structure | ![]() |
| Molecular Formula | C19H13F |
| Molecular Weight | 260.31 |
| CAS Registry Number | 1881-75-0 |
| SMILES | C4=CC3=CC2=C1C=CC=CC1=CC=C2C(=C3C=C4F)C |
| InChI | 1S/C19H13F/c1-12-16-9-7-13-4-2-3-5-17(13)19(16)10-14-6-8-15(20)11-18(12)14/h2-11H,1H3 |
| InChIKey | HERZIRSHNUDONE-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.378°C at 760 mmHg (Cal.) |
| Flash point | 199.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Fluoro-7-Methylbenz[a]Anthracene |