|
CAS#: 18829-59-9 Product: 2,3,4,7,8,8a-Hexahydro-3,6,8,8-Tetramethyl-1H-3a,7-Methanoazulen-4-Ol No suppilers available for the product. |
| Name | 2,3,4,7,8,8a-Hexahydro-3,6,8,8-Tetramethyl-1H-3a,7-Methanoazulen-4-Ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 18829-59-9 |
| EINECS | 242-610-1 |
| SMILES | CC1(C3C2(CC1C(=CC2O)C)C(CC3)C)C |
| InChI | 1S/C15H24O/c1-9-7-13(16)15-8-11(9)14(3,4)12(15)6-5-10(15)2/h7,10-13,16H,5-6,8H2,1-4H3 |
| InChIKey | ONJBGKFFLPNVRV-UHFFFAOYSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.843°C at 760 mmHg (Cal.) |
| Flash point | 127.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,7,8,8a-Hexahydro-3,6,8,8-Tetramethyl-1H-3a,7-Methanoazulen-4-Ol |