|
CAS#: 18865-25-3 Product: 2-Methylthio-4H-1,3,2-Benzodioxaphosphorin 2-Oxide No suppilers available for the product. |
| Name | 2-Methylthio-4H-1,3,2-Benzodioxaphosphorin 2-Oxide |
|---|---|
| Synonyms | 8-(Methylthio)-7,9-Dioxa-8$L^{5}-Phosphabicyclo[4.4.0]Deca-1,3,5-Triene 8-Oxide; 2-Methylthio-4H-1,3,2-Benzodioxaphosphorin 2-Oxide; 4H-1,3,2-Benzodioxaphosphorin, 2-(Methylthio)-, 2-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9O3PS |
| Molecular Weight | 216.19 |
| CAS Registry Number | 18865-25-3 |
| SMILES | C2=C1O[P](SC)(OCC1=CC=C2)=O |
| InChI | 1S/C8H9O3PS/c1-13-12(9)10-6-7-4-2-3-5-8(7)11-12/h2-5H,6H2,1H3 |
| InChIKey | GOAOHVJAXBHBBP-UHFFFAOYSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.809°C at 760 mmHg (Cal.) |
| Flash point | 143.587°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylthio-4H-1,3,2-Benzodioxaphosphorin 2-Oxide |