|
CAS#: 18881-57-7 Product: Diethyldithiocarbamic Acid Trimethylsilyl Ester No suppilers available for the product. |
| Name | Diethyldithiocarbamic Acid Trimethylsilyl Ester |
|---|---|
| Synonyms | Diethylaminomethanedithioic Acid Trimethylsilyl Ester; Carbamodithioic Acid, Diethyl-, Trimethylsilyl Ester; Diethyldithiocarbamic Acid Trimethylsilyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19NS2Si |
| Molecular Weight | 221.45 |
| CAS Registry Number | 18881-57-7 |
| SMILES | C(N(C(S[Si](C)(C)C)=S)CC)C |
| InChI | 1S/C8H19NS2Si/c1-6-9(7-2)8(10)11-12(3,4)5/h6-7H2,1-5H3 |
| InChIKey | OVGUMLRVVXSFAI-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.271°C at 760 mmHg (Cal.) |
| Flash point | 102.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyldithiocarbamic Acid Trimethylsilyl Ester |