|
CAS#: 18892-39-2 Product: 6-Amino-7-Chloro-5,8-Dioxoquinoline No suppilers available for the product. |
| Name | 6-Amino-7-Chloro-5,8-Dioxoquinoline |
|---|---|
| Synonyms | 6-Amino-7-Chloro-Quinoline-5,8-Dione; 6-Amino-7-Chloro-Quinoline-5,8-Quinone; Nsc84998 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60 |
| CAS Registry Number | 18892-39-2 |
| SMILES | C1=C2C(=NC=C1)C(=O)C(=C(N)C2=O)Cl |
| InChI | 1S/C9H5ClN2O2/c10-5-6(11)8(13)4-2-1-3-12-7(4)9(5)14/h1-3H,11H2 |
| InChIKey | KWGIFJNXSKZGKI-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.55°C at 760 mmHg (Cal.) |
| Flash point | 158.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Amino-7-Chloro-5,8-Dioxoquinoline |