|
CAS#: 18994-98-4 Product: 2-Oxo-1,2-Diphenylethyl Acrylate No suppilers available for the product. |
| Name | 2-Oxo-1,2-Diphenylethyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid [2-Oxo-1,2-Di(Phenyl)Ethyl] Ester; Acrylic Acid [2-Keto-1,2-Di(Phenyl)Ethyl] Ester; 2-Oxo-1,2-Diphenylethyl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 18994-98-4 |
| EINECS | 242-730-4 |
| SMILES | C2=C(C(C(OC(=O)C=C)C1=CC=CC=C1)=O)C=CC=C2 |
| InChI | 1S/C17H14O3/c1-2-15(18)20-17(14-11-7-4-8-12-14)16(19)13-9-5-3-6-10-13/h2-12,17H,1H2 |
| InChIKey | MSMAPCFQRXQMRL-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.116°C at 760 mmHg (Cal.) |
| Flash point | 177.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Oxo-1,2-Diphenylethyl Acrylate |