|
CAS#: 19045-79-5 Product: Dipotassium Octyl Phosphate No suppilers available for the product. |
| Name | Dipotassium Octyl Phosphate |
|---|---|
| Synonyms | Hsdb 2620; Octyl Potassium Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17K2O4P |
| Molecular Weight | 286.39 |
| CAS Registry Number | 19045-79-5 (51404-72-9) |
| EINECS | 242-782-8 |
| SMILES | C(O[P]([O-])([O-])=O)CCCCCCC.[K+].[K+] |
| InChI | 1S/C8H19O4P.2K/c1-2-3-4-5-6-7-8-12-13(9,10)11;;/h2-8H2,1H3,(H2,9,10,11);;/q;2*+1/p-2 |
| InChIKey | LPZZAIMVFFLHQU-UHFFFAOYSA-L |
| Boiling point | 328.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium Octyl Phosphate |