|
CAS#: 19064-25-6 Product: Bis(2,6-Difluorophenyl)-Diazene 1-Oxide No suppilers available for the product. |
| Name | Bis(2,6-Difluorophenyl)-Diazene 1-Oxide |
|---|---|
| Synonyms | (2,6-Difluorophenyl)-(2,6-Difluorophenyl)Imino-Oxido-Ammonium; (2,6-Difluorophenyl)-(2,6-Difluorophenyl)Imino-Oxidoammonium; (2,6-Difluorophenyl)-(2,6-Difluorophenyl)Imino-Oxido-Azanium |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6F4N2O |
| Molecular Weight | 270.19 |
| CAS Registry Number | 19064-25-6 |
| SMILES | C1=CC=C(C(=C1F)[N-][N+](=O)C2=C(C=CC=C2F)F)F |
| InChI | 1S/C12H6F4N2O/c13-7-3-1-4-8(14)11(7)17-18(19)12-9(15)5-2-6-10(12)16/h1-6H |
| InChIKey | GPBUEPLVTZPBJK-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.059°C at 760 mmHg (Cal.) |
| Flash point | 163.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2,6-Difluorophenyl)-Diazene 1-Oxide |