|
CAS#: 19137-72-5 Product: 7-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole No suppilers available for the product. |
| Name | 7-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |
|---|---|
| Synonyms | 7-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole; 7-Methyl-3-(1-Methyl-2-Pyrrolidinyl)Indole; Brn 0520980 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 |
| CAS Registry Number | 19137-72-5 |
| SMILES | C1=C(C2=C([NH]1)C(=CC=C2)C)C3N(CCC3)C |
| InChI | 1S/C14H18N2/c1-10-5-3-6-11-12(9-15-14(10)11)13-7-4-8-16(13)2/h3,5-6,9,13,15H,4,7-8H2,1-2H3 |
| InChIKey | PALMSMPURBFZAO-UHFFFAOYSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.695°C at 760 mmHg (Cal.) |
| Flash point | 171.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methyl-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |