|
CAS#: 1915-49-7 Product: 10H-Phenoxazine-2,3-dione No suppilers available for the product. |
| Name | 10H-Phenoxazine-2,3-dione |
|---|---|
| Synonyms | 10H-Phenoxazine-2,3-Quinone; 2-Hydroxyisophenoxazin-3-One; 3H-Phenoxazin-3-One, 2-Hydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 1915-49-7 |
| SMILES | C3=C2NC1=CC(=O)C(=O)C=C1OC2=CC=C3 |
| InChI | 1S/C12H7NO3/c14-9-5-8-12(6-10(9)15)16-11-4-2-1-3-7(11)13-8/h1-6,13H |
| InChIKey | JILUVIVDEFRTKE-UHFFFAOYSA-N |
| Density | 1.468g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.304°C at 760 mmHg (Cal.) |
| Flash point | 139.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10H-Phenoxazine-2,3-dione |