| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (431) 5606-600 | |||
![]() |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,3-Bis-Bromomethyl-1,4-Dimethoxy-Benzene |
|---|---|
| Synonyms | 2,3-Bis(Bromomethyl)-1,4-Dimethoxy-Benzene; Nsc109164 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 |
| CAS Registry Number | 19164-83-1 |
| SMILES | C1=CC(=C(CBr)C(=C1OC)CBr)OC |
| InChI | 1S/C10H12Br2O2/c1-13-9-3-4-10(14-2)8(6-12)7(9)5-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | BESOQRFWCAJXLE-UHFFFAOYSA-N |
| Density | 1.65g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.063°C at 760 mmHg (Cal.) |
| Flash point | 140.019°C (Cal.) |
| (1) | P. Hammershøj and J. B. Christensen. 2,3-Bis(bromomethyl)-1,4-dimethoxybenzene, Acta Cryst. (2005). E61, o2839-o2840 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,3-Bis-Bromomethyl-1,4-Dimethoxy-Benzene |