|
CAS#: 192190-10-6 Product: 2-Chloro-4-(2,3,4,6-Tetrachlorophenyl)Phenol No suppilers available for the product. |
| Name | 2-Chloro-4-(2,3,4,6-Tetrachlorophenyl)Phenol |
|---|---|
| Synonyms | C14378; 4-Hydroxy-2',3,3',4',6'-Pentachlorobiphenyl; [1,1'-Biphenyl]-4-Ol, 2',3,3',4',6'-Pentachloro- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl5O |
| Molecular Weight | 342.44 |
| CAS Registry Number | 192190-10-6 |
| SMILES | C1=CC(=CC(=C1O)Cl)C2=C(C(=C(C=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl5O/c13-6-3-5(1-2-9(6)18)10-7(14)4-8(15)11(16)12(10)17/h1-4,18H |
| InChIKey | QLPPOBFMEBKBOZ-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.439°C at 760 mmHg (Cal.) |
| Flash point | 192.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-(2,3,4,6-Tetrachlorophenyl)Phenol |