|
CAS#: 1923-89-3 Product: 5,6-Epoxy-beta,beta-Carotene No suppilers available for the product. |
| Name | 5,6-Epoxy-beta,beta-Carotene |
|---|---|
| Synonyms | 2,2,6-Trimethyl-1-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-Tetramethyl-18-(2,6,6-Trimethyl-1-Cyclohexenyl)Octadeca-1,3,5,7,9,11,13,15,17-Nonaenyl]-7-Oxabicyclo[4.1.0]Heptane; Lmpr01070267; 5,6-Epoxy-Beta,Beta-Carotene |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.88 |
| CAS Registry Number | 1923-89-3 |
| SMILES | CC13C(O1)(/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)C)C)C)C)C(CCC3)(C)C |
| InChI | 1S/C40H56O/c1-31(19-13-21-33(3)24-25-36-35(5)23-15-27-37(36,6)7)17-11-12-18-32(2)20-14-22-34(4)26-30-40-38(8,9)28-16-29-39(40,10)41-40/h11-14,17-22,24-26,30H,15-16,23,27-29H2,1-10H3/b12-11+,19-13+,20-14+,25-24+,30-26+,31-17+,32-18+,33-21+,34-22+ |
| InChIKey | RVCRIPILOFSMFG-WWSVUWEKSA-N |
| Density | 0.987g/cm3 (Cal.) |
|---|---|
| Boiling point | 649.637°C at 760 mmHg (Cal.) |
| Flash point | 317.394°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5,6-Epoxy-beta,beta-Carotene |