| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Alanine derivatives |
|---|---|
| Name | N-Acetyl-L-Alanyl-L-Alanyl-L-Alanine |
| Synonyms | (2S)-2-[[(2S)-2-[[(2S)-2-Acetamido-1-Oxopropyl]Amino]-1-Oxopropyl]Amino]Propanoate; (2S)-2-[[(2S)-2-[[(2S)-2-Acetamidopropanoyl]Amino]Propanoyl]Amino]Propionate; Zinc02242696 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18N3O5 |
| Molecular Weight | 272.28 |
| CAS Registry Number | 19245-85-3 |
| EINECS | 242-912-3 |
| SMILES | [C@@H](NC(=O)[C@@H](NC(=O)C)C)(C(=O)N[C@@H](C)C([O-])=O)C |
| InChI | 1S/C11H19N3O5/c1-5(12-8(4)15)9(16)13-6(2)10(17)14-7(3)11(18)19/h5-7H,1-4H3,(H,12,15)(H,13,16)(H,14,17)(H,18,19)/p-1/t5-,6-,7-/m0/s1 |
| InChIKey | DRYOODAJROGPQO-ACZMJKKPSA-M |
| Boiling point | 685.198°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 368.195°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-L-Alanyl-L-Alanyl-L-Alanine |