Online Database of Chemicals from Around the World
|
CAS#: 19274-72-7 Product: 1,8-Dibenzoylnaphthalene No suppilers available for the product. |
| Name | 1,8-Dibenzoylnaphthalene |
|---|---|
| Synonyms | [8-(Benzoyl)-1-Naphthyl]-Phenyl-Methanone; [8-(Oxo-Phenylmethyl)-1-Naphthyl]-Phenylmethanone; Phenyl-(8-Phenylcarbonylnaphthalen-1-Yl)Methanone |
| Molecular Structure |  |
| Molecular Formula | C24H16O2 |
| Molecular Weight | 336.39 |
| CAS Registry Number | 19274-72-7 |
| EINECS | 242-929-6 |
| SMILES | C1=CC=C3C(=C1C(C2=CC=CC=C2)=O)C(=CC=C3)C(C4=CC=CC=C4)=O |
| InChI | 1S/C24H16O2/c25-23(18-9-3-1-4-10-18)20-15-7-13-17-14-8-16-21(22(17)20)24(26)19-11-5-2-6-12-19/h1-16H |
| InChIKey | QPKUOOVISUGIRK-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.316°C at 760 mmHg (Cal.) |
| Flash point | 195.768°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,8-Dibenzoylnaphthalene |