|
CAS#: 19291-69-1 Product: Gestaclone No suppilers available for the product. |
| Name | Gestaclone |
|---|---|
| Synonyms | Gestaclone [Usan:Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C23H27ClO2 |
| Molecular Weight | 370.92 |
| CAS Registry Number | 19291-69-1 |
| SMILES | CC(=O)C15CC1CC6C4C=C(Cl)C3=CC(=O)C2CC2C3(C)C4CCC56C |
| InChI | 1S/C23H27ClO2/c1-11(25)23-10-12(23)6-16-13-8-19(24)18-9-20(26)14-7-17(14)22(18,3)15(13)4-5-21(16,23)2/h8-9,12-17H,4-7,10H2,1-3H3 |
| InChIKey | VUWYSFAIXUWQRQ-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.43°C at 760 mmHg (Cal.) |
| Flash point | 206.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Gestaclone |