|
CAS#: 19305-94-3 Product: 4-Bromo-2,6-Adamantanedione No suppilers available for the product. |
| Name | 4-Bromo-2,6-Adamantanedione |
|---|---|
| Synonyms | 2,6-Adamantanedione, 4-bromo-, (1R)-; 4-Bromo-2,6-adamantanedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 |
| CAS Registry Number | 19305-94-3 |
| SMILES | O=C2C1CC3C(=O)C(C1)CC2C3Br |
| InChI | 1S/C10H11BrO2/c11-8-6-2-4-1-5(10(6)13)3-7(8)9(4)12/h4-8H,1-3H2 |
| InChIKey | SUAVLQQWUUFEBF-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.972°C at 760 mmHg (Cal.) |
| Flash point | 143.083°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2,6-Adamantanedione |