|
CAS#: 19371-58-5 Product: 9,12-Dimethyl-1,2-Benzanthracene No suppilers available for the product. |
| Name | 9,12-Dimethyl-1,2-Benzanthracene |
|---|---|
| Synonyms | 9,12-Dimethyl-1,2-Benz(A)Anthracene; 9,12-Dimethyl-1,2-Benzanthracene; Benz(A)Anthracene, 9,12-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 |
| CAS Registry Number | 19371-58-5 |
| SMILES | C3=CC2=CC1=CC(=CC=C1C(=C2C4=CC=CC=C34)C)C |
| InChI | 1S/C20H16/c1-13-7-10-18-14(2)20-16(12-17(18)11-13)9-8-15-5-3-4-6-19(15)20/h3-12H,1-2H3 |
| InChIKey | CYRPSEXQZAFVGE-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.333°C at 760 mmHg (Cal.) |
| Flash point | 226.642°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,12-Dimethyl-1,2-Benzanthracene |