|
CAS#: 19420-45-2 Product: [2-Amino-4-(Trifluoromethyl)Phenyl] Ethyl Carbonate No suppilers available for the product. |
| Name | [2-Amino-4-(Trifluoromethyl)Phenyl] Ethyl Carbonate |
|---|---|
| Synonyms | Carbonic Acid [2-Amino-4-(Trifluoromethyl)Phenyl] Ethyl Ester; Brn 2866001; Carbonic Acid, 2-Amino-Alpha,Alpha,Alpha-Trifluoro-P-Tolyl Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 |
| CAS Registry Number | 19420-45-2 |
| SMILES | C1=C(C(=CC=C1C(F)(F)F)OC(OCC)=O)N |
| InChI | 1S/C10H10F3NO3/c1-2-16-9(15)17-8-4-3-6(5-7(8)14)10(11,12)13/h3-5H,2,14H2,1H3 |
| InChIKey | VEACMVSUSKECKC-UHFFFAOYSA-N |
| Density | 1.342g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.404°C at 760 mmHg (Cal.) |
| Flash point | 139.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-Amino-4-(Trifluoromethyl)Phenyl] Ethyl Carbonate |