|
CAS#: 1945-68-2 Product: Ethylglyoxal Bis(Guanylhydrazone) No suppilers available for the product. |
| Name | Ethylglyoxal Bis(Guanylhydrazone) |
|---|---|
| Synonyms | 2-[1-[(E)-(Diaminomethylenehydrazono)Methyl]Propylideneamino]Guanidine; Sulfuric Acid; 2,2'-(1-Ethyl-1,2-Ethanediylidene)Bishydrazinecarboximidamide Sulfate; Hydrazinecarboximidamide, 2,2'-(1-Ethyl-1,2-Ethanediylidene)Bis-, Sulfate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16N8O4S |
| Molecular Weight | 296.30 |
| CAS Registry Number | 1945-68-2 |
| SMILES | O=[S](O)(O)=O.C(C(=N/N=C(N)N)\C=N\N=C(N)N)C |
| InChI | 1S/C6H14N8.H2O4S/c1-2-4(12-14-6(9)10)3-11-13-5(7)8;1-5(2,3)4/h3H,2H2,1H3,(H4,7,8,13)(H4,9,10,14);(H2,1,2,3,4)/b11-3+,12-4+; |
| InChIKey | DQUYNFXKONJOEM-FLVPNXLJSA-N |
| Boiling point | 440°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 219.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylglyoxal Bis(Guanylhydrazone) |