|
CAS#: 19480-40-1 Product: Potassium 4-(2,4-Dichlorophenoxy)Butyrate No suppilers available for the product. |
| Name | Potassium 4-(2,4-Dichlorophenoxy)Butyrate |
|---|---|
| Synonyms | Potassium 4-(2,4-Dichlorophenoxy)Butyrate; 2,4-Db-Potassium |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl2KO3 |
| Molecular Weight | 287.18 |
| CAS Registry Number | 19480-40-1 |
| EINECS | 243-102-2 |
| SMILES | C1=C(Cl)C(=CC=C1Cl)OCCCC([O-])=O.[K+] |
| InChI | 1S/C10H10Cl2O3.K/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;/h3-4,6H,1-2,5H2,(H,13,14);/q;+1/p-1 |
| InChIKey | WRBJKRRJBCSNLE-UHFFFAOYSA-M |
| Boiling point | 410.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium 4-(2,4-Dichlorophenoxy)Butyrate |