|
CAS#: 19486-60-3 Product: 2-Isopropyl-1,1'-Biphenyl No suppilers available for the product. |
| Name | 2-Isopropyl-1,1'-Biphenyl |
|---|---|
| Synonyms | 1-Isopropyl-2-Phenyl-Benzene; 1-Isopropyl-2-Phenylbenzene; 1-Phenyl-2-Propan-2-Yl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 19486-60-3 |
| SMILES | C1=C(C(=CC=C1)C2=CC=CC=C2)C(C)C |
| InChI | 1S/C15H16/c1-12(2)14-10-6-7-11-15(14)13-8-4-3-5-9-13/h3-12H,1-2H3 |
| InChIKey | HKTCLPBBJDIBGF-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.824°C at 760 mmHg (Cal.) |
| Flash point | 140.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-1,1'-Biphenyl |