|
CAS#: 1955-73-3 Product: Disodium Galactarate No suppilers available for the product. |
| Name | Disodium Galactarate |
|---|---|
| Synonyms | Disodium (2S,3R,4S,5R)-2,3,4,5-Tetrahydroxyadipate; Disodium Galactarate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Na2O8 |
| Molecular Weight | 254.10 |
| CAS Registry Number | 1955-73-3 |
| EINECS | 217-794-1 |
| SMILES | [C@@H](O)([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C([O-])=O.[Na+].[Na+] |
| InChI | 1S/C6H10O8.2Na/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;/h1-4,7-10H,(H,11,12)(H,13,14);;/q;2*+1/p-2/t1-,2+,3+,4-;; |
| InChIKey | IDAGXRIGDWCIET-SXKXKJGMSA-L |
| Boiling point | 766.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 431.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Galactarate |