|
CAS#: 1960-60-7 Product: 2-Amino-3-Bromo-7-Fluoro-9H-Fluoren-9-Ol No suppilers available for the product. |
| Name | 2-Amino-3-Bromo-7-Fluoro-9H-Fluoren-9-Ol |
|---|---|
| Synonyms | Nsc73070; Nciopen2_003796 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9BrFNO |
| Molecular Weight | 294.12 |
| CAS Registry Number | 1960-60-7 |
| SMILES | C1=C(C=C2C(=C1)C3=C(C2O)C=C(C(=C3)Br)N)F |
| InChI | 1S/C13H9BrFNO/c14-11-4-8-7-2-1-6(15)3-9(7)13(17)10(8)5-12(11)16/h1-5,13,17H,16H2 |
| InChIKey | CQNHTYFQSULBMH-UHFFFAOYSA-N |
| Density | 1.751g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.797°C at 760 mmHg (Cal.) |
| Flash point | 230.063°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-3-Bromo-7-Fluoro-9H-Fluoren-9-Ol |