|
CAS#: 19618-06-5 Product: 1-Methyl-3-[(3-methylphenyl)azoxy]benzene No suppilers available for the product. |
| Name | 1-Methyl-3-[(3-methylphenyl)azoxy]benzene |
|---|---|
| Synonyms | Bis(3-methylphenyl)diazene 1-oxide; BIS(3-METHYLPHENYL)DIAZENE, 1-OXIDE; m,m'-Azoxytoluene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.27 |
| CAS Registry Number | 19618-06-5 |
| SMILES | Cc1cccc(c1)N=[N+](c2cccc(c2)C)[O-] |
| InChI | 1S/C14H14N2O/c1-11-5-3-7-13(9-11)15-16(17)14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | OCIMXNSZRVIRQB-UHFFFAOYSA-N |
| Density | 1.067g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.632°C at 760 mmHg (Cal.) |
| Flash point | 187.628°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3-[(3-methylphenyl)azoxy]benzene |