|
CAS#: 19685-58-6 Product: 3,3-Bis(P-Chlorophenyl)-1,1,2-Trichloro-1-Propene No suppilers available for the product. |
| Name | 3,3-Bis(P-Chlorophenyl)-1,1,2-Trichloro-1-Propene |
|---|---|
| Synonyms | 1-Propene, 3,3-Bis(P-Chlorophenyl)-1,1,2-Trichloro-; 3,3-Bis(P-Chlorophenyl)-2-Chloro-1,1-Dichloropropylene; 3-05-00-02000 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9Cl5 |
| Molecular Weight | 366.50 |
| CAS Registry Number | 19685-58-6 |
| SMILES | C1=CC(=CC=C1C(C(=C(Cl)Cl)Cl)C2=CC=C(C=C2)Cl)Cl |
| InChI | 1S/C15H9Cl5/c16-11-5-1-9(2-6-11)13(14(18)15(19)20)10-3-7-12(17)8-4-10/h1-8,13H |
| InChIKey | GIOLCFQEOSBDPL-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.824°C at 760 mmHg (Cal.) |
| Flash point | 218.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(P-Chlorophenyl)-1,1,2-Trichloro-1-Propene |