|
CAS#: 19720-42-4 Product: 1,4-Bis((1,3-Dimethylbutyl)Amino)-Anthraquinone No suppilers available for the product. |
| Name | 1,4-Bis((1,3-Dimethylbutyl)Amino)-Anthraquinone |
|---|---|
| Synonyms | 1,4-Bis(1,3-Dimethylbutylamino)Anthracene-9,10-Dione; 1,4-Bis(1,3-Dimethylbutylamino)-9,10-Anthraquinone; 9,10-Anthracenedione, 1,4-Bis((1,3-Dimethylbutyl)Amino)- |
| Molecular Structure | ![]() |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 |
| CAS Registry Number | 19720-42-4 |
| SMILES | C1=CC2=C(C=C1)C(=O)C3=C(C2=O)C(=CC=C3NC(CC(C)C)C)NC(CC(C)C)C |
| InChI | 1S/C26H34N2O2/c1-15(2)13-17(5)27-21-11-12-22(28-18(6)14-16(3)4)24-23(21)25(29)19-9-7-8-10-20(19)26(24)30/h7-12,15-18,27-28H,13-14H2,1-6H3 |
| InChIKey | LOIONYUPSGYWKG-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.998°C at 760 mmHg (Cal.) |
| Flash point | 164.115°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis((1,3-Dimethylbutyl)Amino)-Anthraquinone |