| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Leucine derivative |
|---|---|
| Name | N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Leucine |
| Synonyms | (2S)-2-{[ |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.39 |
| CAS Registry Number | 197245-21-9 |
| SMILES | O=C(O)[C@@H](NC(=O)OC\C2=C\c1ccccc1S2(=O)=O)CC(C)C |
| InChI | 1S/C16H19NO6S/c1-10(2)7-13(15(18)19)17-16(20)23-9-12-8-11-5-3-4-6-14(11)24(12,21)22/h3-6,8,10,13H,7,9H2,1-2H3,(H,17,20)(H,18,19)/t13-/m0/s1 |
| InChIKey | OMRCRRODQMLMIU-ZDUSSCGKSA-N |
| Density | 1.356g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.49°C at 760 mmHg (Cal.) |
| Flash point | 320.594°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-{[(1,1-Dioxido-1-Benzothiophen-2-Yl)Methoxy]Carbonyl}-L-Leucine |