|
CAS#: 19889-60-2 Product: 2-Iodo-N-(2,4,5-Trichlorophenyl)Acetamide No suppilers available for the product. |
| Name | 2-Iodo-N-(2,4,5-Trichlorophenyl)Acetamide |
|---|---|
| Synonyms | 2-Iodo-N-(2,4,5-Trichlorophenyl)Ethanamide; 2',4',5'-Trichloro-2-Iodoacetanilide; 2-Iodo-2',4',5'-Trichloroacetanilide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5Cl3INO |
| Molecular Weight | 364.40 |
| CAS Registry Number | 19889-60-2 |
| SMILES | C1=C(C(=CC(=C1NC(CI)=O)Cl)Cl)Cl |
| InChI | 1S/C8H5Cl3INO/c9-4-1-6(11)7(2-5(4)10)13-8(14)3-12/h1-2H,3H2,(H,13,14) |
| InChIKey | WAPYQUGYVRUXTH-UHFFFAOYSA-N |
| Density | 2.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.951°C at 760 mmHg (Cal.) |
| Flash point | 218.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Iodo-N-(2,4,5-Trichlorophenyl)Acetamide |