|
CAS#: 19891-29-3 Product: Kaurane-3,16,17-Triol No suppilers available for the product. |
| Name | Kaurane-3,16,17-Triol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.48 |
| CAS Registry Number | 19891-29-3 |
| SMILES | OC[C@]3(O)C[C@@]24CC[C@@H]1[C@](C)(CCC(O)[C@]1(C)C)[C@H]4CC[C@H]3C2 |
| InChI | 1S/C20H34O3/c1-17(2)14-6-9-19-10-13(20(23,11-19)12-21)4-5-15(19)18(14,3)8-7-16(17)22/h13-16,21-23H,4-12H2,1-3H3/t13-,14-,15+,16?,18-,19+,20+/m0/s1 |
| InChIKey | JRMZVZSBORMZSD-GUBPSYDYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.624°C at 760 mmHg (Cal.) |
| Flash point | 207.058°C (Cal.) |
| Refractive index | 1.567 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Kaurane-3,16,17-Triol |