|
CAS#: 19896-10-7 Product: 2,3,4,6-Tetrakis-O-(3-Nitropropanoyl)-beta-D-Glucopyranose No suppilers available for the product. |
| Name | 2,3,4,6-Tetrakis-O-(3-Nitropropanoyl)-beta-D-Glucopyranose |
|---|---|
| Synonyms | ENDECAPHYLLIN X; KBio3_002098 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N4O18 |
| Molecular Weight | 584.40 |
| CAS Registry Number | 19896-10-7 |
| SMILES | [O-][N+](=O)CCC(=O)OC[C@H]1O[C@@H](O)[C@H](OC(=O)CC[N+]([O-])=O)[C@@H](OC(=O)CC[N+]([O-])=O)[C@@H]1OC(=O)CC[N+]([O-])=O |
| InChI | 1S/C18H24N4O18/c23-11(1-5-19(28)29)36-9-10-15(38-12(24)2-6-20(30)31)16(39-13(25)3-7-21(32)33)17(18(27)37-10)40-14(26)4-8-22(34)35/h10,15-18,27H,1-9H2/t10-,15-,16+,17-,18-/m1/s1 |
| InChIKey | JMPKPWBLQUWFHQ-LUAGPVBASA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 759.988°C at 760 mmHg (Cal.) |
| Flash point | 413.426°C (Cal.) |
| Refractive index | 1.551 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6-Tetrakis-O-(3-Nitropropanoyl)-beta-D-Glucopyranose |