|
CAS#: 19899-32-2 Product: (1R,2S,3S,5S)-1,2,3,5-Tetramethylcyclohexane No suppilers available for the product. |
| Name | (1R,2S,3S,5S)-1,2,3,5-Tetramethylcyclohexane |
|---|---|
| Synonyms | (1α,2α,3α,5β)-1,2,3,5-tetramethylcyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 |
| CAS Registry Number | 19899-32-2 |
| EINECS | 243-419-6 |
| SMILES | C[C@H]1C[C@H](C)[C@H](C)[C@H](C)C1 |
| InChI | 1S/C10H20/c1-7-5-8(2)10(4)9(3)6-7/h7-10H,5-6H2,1-4H3/t7-,8-,9+,10- |
| InChIKey | HLPYGMSCWOQRJN-MSLAYNRJSA-N |
| Density | 0.752g/cm3 (Cal.) |
|---|---|
| Boiling point | 160.394°C at 760 mmHg (Cal.) |
| Flash point | 40.521°C (Cal.) |
| Refractive index | 1.413 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S,3S,5S)-1,2,3,5-Tetramethylcyclohexane |