|
CAS#: 1990-01-8 Product: Glaucarubolone No suppilers available for the product. |
| Name | Glaucarubolone |
|---|---|
| Synonyms | C08764; Glaucarubolone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 |
| CAS Registry Number | 1990-01-8 |
| SMILES | [C@@]123[C@@H]4[C@@](O)(OC1)[C@@H]([C@@H]([C@@H]2[C@@H](O)C(O[C@@H]3C[C@H]5C(=CC([C@H]([C@]45C)O)=O)C)=O)C)O |
| InChI | 1S/C20H26O8/c1-7-4-10(21)15(24)18(3)9(7)5-11-19-6-27-20(26,17(18)19)14(23)8(2)12(19)13(22)16(25)28-11/h4,8-9,11-15,17,22-24,26H,5-6H2,1-3H3/t8-,9+,11-,12-,13-,14-,15-,17-,18-,19+,20+/m1/s1 |
| InChIKey | FJHVIRYYVWNHSM-FOSMHHDRSA-N |
| Density | 1.527g/cm3 (Cal.) |
|---|---|
| Boiling point | 652.778°C at 760 mmHg (Cal.) |
| Flash point | 233.852°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glaucarubolone |