|
CAS#: 19912-61-9 Product: Furanodiene No suppilers available for the product. |
| Name | Furanodiene |
|---|---|
| Synonyms | Furanodiene; 3,6,10-Trimethyl-4,7,8,11-Tetrahydro-Cyclodeca[B]Furan; Cyclodeca[B]Furan, 4,7,8,11-Tetrahydro-3,6,10-Trimethyl-, (5E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 |
| CAS Registry Number | 19912-61-9 |
| SMILES | C1=C(C2=C(O1)CC(=C/CCC(=C/C2)/C)/C)C |
| InChI | 1S/C15H20O/c1-11-5-4-6-12(2)9-15-14(8-7-11)13(3)10-16-15/h6-7,10H,4-5,8-9H2,1-3H3/b11-7+,12-6+ |
| InChIKey | VMDXHYHOJPKFEK-IAVOFVOCSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.646°C at 760 mmHg (Cal.) |
| Flash point | 137.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Furanodiene |