Online Database of Chemicals from Around the World
|
CAS#: 199594-59-7 Product: 2-(2,6-Difluorophenyl)-1-[(2,6-Difluorophenyl)Methyl]Benzimidazole No suppilers available for the product. |
| Name | 2-(2,6-Difluorophenyl)-1-[(2,6-Difluorophenyl)Methyl]Benzimidazole |
|---|---|
| Synonyms | 1-(2,6-Difluorobenzyl)-2-(2,6-Difluorophenyl)Benzimidazole; Aids-058867; Aids058867 |
| Molecular Structure | ![CAS#: 199594-59-7, 2-(2,6-Difluorophenyl)-1-[(2,6-Difluorophenyl)Methyl]Benzimidazole](/moreStructures/199594-59-7.gif) |
| Molecular Formula | C20H12F4N2 |
| Molecular Weight | 356.32 |
| CAS Registry Number | 199594-59-7 |
| SMILES | C1=CC=CC2=C1[N](C(=N2)C3=C(F)C=CC=C3F)CC4=C(F)C=CC=C4F |
| InChI | 1S/C20H12F4N2/c21-13-5-3-6-14(22)12(13)11-26-18-10-2-1-9-17(18)25-20(26)19-15(23)7-4-8-16(19)24/h1-10H,11H2 |
| InChIKey | MDIRLWZOKMHIJZ-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.469°C at 760 mmHg (Cal.) |
| Flash point | 245.588°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,6-Difluorophenyl)-1-[(2,6-Difluorophenyl)Methyl]Benzimidazole |