|
CAS#: 20010-90-6 Product: 5,6-Dimethylbenz(a)Phenazine No suppilers available for the product. |
| Name | 5,6-Dimethylbenz(a)Phenazine |
|---|---|
| Synonyms | Nsc 150203; 5,6-Dimethylbenzo(A)Phenazine; 5,6-Dimethylbenz(A)Phenazine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 |
| CAS Registry Number | 20010-90-6 |
| SMILES | C4=C3C2=NC1=CC=CC=C1N=C2C(=C(C3=CC=C4)C)C |
| InChI | 1S/C18H14N2/c1-11-12(2)17-18(14-8-4-3-7-13(11)14)20-16-10-6-5-9-15(16)19-17/h3-10H,1-2H3 |
| InChIKey | IKDXAMKMPBBXOA-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.066°C at 760 mmHg (Cal.) |
| Flash point | 218.177°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dimethylbenz(a)Phenazine |