|
CAS#: 2002-28-0 Product: [(2R,3R)-2,3-Dihydroxy-4-Oxo-5-Phosphonooxypentyl] Dihydrogen Phosphate No suppilers available for the product. |
| Name | [(2R,3R)-2,3-Dihydroxy-4-Oxo-5-Phosphonooxypentyl] Dihydrogen Phosphate |
|---|---|
| Synonyms | [(2R,3R)-2,3-Dihydroxy-4-Oxo-5-Phosphonooxy-Pentyl] Dihydrogen Phosphate; [(2R,3R)-2,3-Dihydroxy-4-Keto-5-Phosphonooxy-Pentyl] Dihydrogen Phosphate; Ribulose-1,5 Diphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H12O11P2 |
| Molecular Weight | 310.09 |
| CAS Registry Number | 2002-28-0 |
| SMILES | [C@H](C(CO[P](=O)(O)O)=O)([C@@H](CO[P](=O)(O)O)O)O |
| InChI | 1S/C5H12O11P2/c6-3(1-15-17(9,10)11)5(8)4(7)2-16-18(12,13)14/h3,5-6,8H,1-2H2,(H2,9,10,11)(H2,12,13,14)/t3-,5-/m1/s1 |
| InChIKey | YAHZABJORDUQGO-NQXXGFSBSA-N |
| Density | 2.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 751.626°C at 760 mmHg (Cal.) |
| Flash point | 408.369°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(2R,3R)-2,3-Dihydroxy-4-Oxo-5-Phosphonooxypentyl] Dihydrogen Phosphate |