|
CAS#: 2003-44-3 Product: 1,1-Bis(2-Chloroethyl)-3-Naphthalen-1-Ylurea No suppilers available for the product. |
| Name | 1,1-Bis(2-Chloroethyl)-3-Naphthalen-1-Ylurea |
|---|---|
| Synonyms | 1,1-Bis(2-Chloroethyl)-3-(1-Naphthyl)Urea; 1,1-Bis(2-Chloroethyl)-3-Naphthalen-1-Yl-Urea; Nsc84151 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 |
| CAS Registry Number | 2003-44-3 |
| SMILES | C1=CC2=C(C=C1)C(=CC=C2)NC(=O)N(CCCl)CCCl |
| InChI | 1S/C15H16Cl2N2O/c16-8-10-19(11-9-17)15(20)18-14-7-3-5-12-4-1-2-6-13(12)14/h1-7H,8-11H2,(H,18,20) |
| InChIKey | ACCSWAHUGLGDLY-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.084°C at 760 mmHg (Cal.) |
| Flash point | 271.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Bis(2-Chloroethyl)-3-Naphthalen-1-Ylurea |